![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Ends and Means.html | 2024-04-27 23:17 | 180K | |
| Ethical justifications for Israeli actions.html | 2024-04-24 17:24 | 231K | |
| Exploring Meaning Across Disciplines.html | 2024-05-29 19:57 | 894K | |
| Good vs. Moral Theories.html | 2024-05-22 22:07 | 203K | |
| Language and Morality.txt | 2024-03-24 23:12 | 4.3K | |
| Legal vs. Factual Reasoning.pdf | 2024-03-18 10:57 | 63K | |
| Lying Philosophy, Ethics, Psychology.html | 2024-05-28 11:30 | 1.2M | |
| Nature of Language Structure.html | 2024-03-24 22:36 | 38K | |
| Philosophy's Practical Functions.html | 2024-03-26 00:51 | 78K | |
| Reasonableness Explained_ Philosophy and Application.html | 2024-05-17 22:15 | 279K | |
| Righteous Mind Insights.html | 2024-04-01 11:09 | 152K | |
| Self-Deception Philosophical Exploration.html | 2024-05-28 13:14 | 249K | |
| Study of Meaning.pdf | 2024-05-29 10:55 | 790K | |
| Understanding Concepts of Goodness.html | 2024-05-23 14:09 | 444K | |
| Wisdom: Multifaceted Concept.html | 2024-05-20 16:23 | 225K | |
| Wise Politician.html | 2024-05-20 21:45 | 297K | |